In order to avoid security-related warning messages when switching to secured connection, you may want either to:
Click here to proceed.
| Name | 4-Hydroxy-phenylglycine |
| Molecular Weight [g/mol] | 168.17 |
| logP | -2.06 (predicted) |
| Sidechain logP | 1.5 |
| Volume [Å3 ] | 183.66 |
| Sidechain Volume [Å3 ] | 97.99 |
| pKa | 1.74 / 8.75 / 9.59 (predicted) |
| SMILES | OC(=O)[C@H](c1ccc(cc1)O)[NH3] |
| D-amino acid code | DD4P ;(PDB: GHP) |
| PDB References: | |
| L-amino acid | PDB | Ligand |
| D-amino acid | PDB | Ligand |
| PubChem | L: 36143 | D: 89853 |
| CAS number | L: 32462-30-9 | D: 22818-40-2 |